(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(4-chloro-2-methyl-phenoxy)acetate structure
|
Common Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(4-chloro-2-methyl-phenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 7462-15-9 | Molecular Weight | 314.76100 | |
| Density | 1.195g/cm3 | Boiling Point | 401.8ºC at 760 mmHg | |
| Molecular Formula | C15H19ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.3ºC | |
| Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(4-chloro-2-methylphenoxy)acetate |
|---|
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 401.8ºC at 760 mmHg |
| Molecular Formula | C15H19ClO5 |
| Molecular Weight | 314.76100 |
| Flash Point | 150.3ºC |
| Exact Mass | 314.09200 |
| PSA | 53.99000 |
| LogP | 2.72190 |
| Index of Refraction | 1.504 |
| InChIKey | FHHZEZUCHRSNDC-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)OCC1COC(C)(C)O1 |
|
~%
(2,2-dimethyl-1... CAS#:7462-15-9 |
| Literature: Newman; Fones; Renoll Journal of the American Chemical Society, 1947 , vol. 69, p. 718,721 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |