Ethanediamide,N1,N2-dioctyl- structure
|
Common Name | Ethanediamide,N1,N2-dioctyl- | ||
|---|---|---|---|---|
| CAS Number | 7462-50-2 | Molecular Weight | 312.49100 | |
| Density | 0.925g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H36N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-dioctyloxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.925g/cm3 |
|---|---|
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.49100 |
| Exact Mass | 312.27800 |
| PSA | 58.20000 |
| LogP | 4.72160 |
| Index of Refraction | 1.461 |
| InChIKey | SIDCXXDUSLLCNK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCNC(=O)C(=O)NCCCCCCCC |
|
~%
Ethanediamide,N... CAS#:7462-50-2 |
| Literature: Rice et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 242,1750 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-dioctyl-oxalamide |
| N-octyl-N'-octylethane-1,2-diamide |
| N,N'-Dioctyloxamid |
| N,N'-Dioctyl-oxalamid |
| Oxalsaeure-bis-octylamid |