2-(propanoylamino)pentan-3-yl propanoate structure
|
Common Name | 2-(propanoylamino)pentan-3-yl propanoate | ||
|---|---|---|---|---|
| CAS Number | 7462-65-9 | Molecular Weight | 215.28900 | |
| Density | 0.977g/cm3 | Boiling Point | 350.8ºC at 760 mmHg | |
| Molecular Formula | C11H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166ºC | |
| Name | 2-(propanoylamino)pentan-3-yl propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.977g/cm3 |
|---|---|
| Boiling Point | 350.8ºC at 760 mmHg |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.28900 |
| Flash Point | 166ºC |
| Exact Mass | 215.15200 |
| PSA | 55.40000 |
| LogP | 2.02380 |
| Index of Refraction | 1.442 |
| InChIKey | JBMUNVNMQTUSFE-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC(C)C(CC)OC(=O)CC |
|
~%
2-(propanoylami... CAS#:7462-65-9 |
| Literature: Gillis Journal of Organic Chemistry, 1959 , vol. 24, p. 1027 |
|
~%
2-(propanoylami... CAS#:7462-65-9 |
| Literature: Gillis Journal of Organic Chemistry, 1959 , vol. 24, p. 1027 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-propionylamino-3-propionyloxy-pentane |