2-hydroxy-2-methyl-1-(4-phenylphenyl)butan-1-one structure
|
Common Name | 2-hydroxy-2-methyl-1-(4-phenylphenyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 7462-83-1 | Molecular Weight | 254.32400 | |
| Density | 1.089g/cm3 | Boiling Point | 400.3ºC at 760 mmHg | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171ºC | |
| Name | 2-hydroxy-2-methyl-1-(4-phenylphenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 400.3ºC at 760 mmHg |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.32400 |
| Flash Point | 171ºC |
| Exact Mass | 254.13100 |
| PSA | 37.30000 |
| LogP | 3.69730 |
| Index of Refraction | 1.567 |
| InChIKey | BHCFRKIKUBJVGQ-UHFFFAOYSA-N |
| SMILES | CCC(C)(O)C(=O)c1ccc(-c2ccccc2)cc1 |
|
~%
2-hydroxy-2-met... CAS#:7462-83-1 |
| Literature: Stevens; Dykstra Journal of the American Chemical Society, 1954 , vol. 76, p. 4402,4404 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-biphenyl-4-yl-2-hydroxy-2-methyl-butan-1-one |