[7-(benzoyloxymethyl)-5,6-dihydroxy-1,3-dioxepan-4-yl]methyl benzoate structure
|
Common Name | [7-(benzoyloxymethyl)-5,6-dihydroxy-1,3-dioxepan-4-yl]methyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 74628-94-7 | Molecular Weight | 402.39500 | |
| Density | 1.31g/cm3 | Boiling Point | 581.2ºC at 760 mmHg | |
| Molecular Formula | C21H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.9ºC | |
| Name | [7-(benzoyloxymethyl)-5,6-dihydroxy-1,3-dioxepan-4-yl]methyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 581.2ºC at 760 mmHg |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.39500 |
| Flash Point | 202.9ºC |
| Exact Mass | 402.13100 |
| PSA | 111.52000 |
| LogP | 1.16370 |
| Index of Refraction | 1.575 |
| InChIKey | SYMKKOZGTPZQCY-UHFFFAOYSA-N |
| SMILES | O=C(OCC1OCOC(COC(=O)c2ccccc2)C(O)C1O)c1ccccc1 |
|
~%
[7-(benzoyloxym... CAS#:74628-94-7 |
| Literature: Ness; Hann; Hudson Journal of the American Chemical Society, 1943 , vol. 65, p. 2218 Journal of the American Chemical Society, 1944 , vol. 66, p. 1910 |
|
~%
[7-(benzoyloxym... CAS#:74628-94-7 |
| Literature: Morpain, Claude; Fousseret-Dodane, Evelyne; Tisserand, Madeleine Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1 - 6 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| O1,O6-Dibenzoyl-O2,O5-methandiyl-D-mannit |
| O1,O6-dibenzoyl-O2,O5-methanediyl-D-mannitol |
| [5,6-Dihydroxy-7-(phenylcarbonyloxymethyl)-1,3-dioxepan-4-yl]methyl benzoate |