spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide
![spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide Structure](https://image.chemsrc.com/caspic/479/7463-07-2.png)
spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide structure
|
Common Name | spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide | ||
|---|---|---|---|---|
| CAS Number | 7463-07-2 | Molecular Weight | 282.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20BrN |
|---|---|
| Molecular Weight | 282.21900 |
| Exact Mass | 281.07800 |
| LogP | 0.05380 |
| InChIKey | OEIZYFXQQACXTK-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc2c(c1)C[N+]1(CCCCCC1)C2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
spiro[1,3-dihyd... CAS#:7463-07-2 |
| Literature: Blicke; Hotelling Journal of the American Chemical Society, 1954 , vol. 76, p. 5099,5100 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,4,5,6,7-Hexahydro-spiro[azepin-1,2'-isoindolinium],Bromid |
| 2,3,4,5,6,7-hexahydro-spiro[azepine-1,2'-isoindolinium],bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide? |
| A: The English name of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide is spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide. |
| Q: What is the LogP of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide? |
| A: LogP of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide is 0.05380. |
| Q: What English synonyms does spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide have? |
| A: English synonyms of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide: 2,3,4,5,6,7-Hexahydro-spiro[azepin-1,2'-isoindolinium],Bromid, 2,3,4,5,6,7-hexahydro-spiro[azepine-1,2'-isoindolinium],bromide. |
| Q: What is the molecular weight of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide? |
| A: Molecular weight of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide is 282.21900. |
| Q: What is the InChIKey of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide? |
| A: InChIKey of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide is OEIZYFXQQACXTK-UHFFFAOYSA-M. |
| Q: What is the CAS number of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide? |
| A: CAS number of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide is 7463-07-2. |
| Q: What is the molecular formula of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide? |
| A: Molecular formula of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide is C14H20BrN. |
| Q: What are the upstream materials of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide? |
| A: Related upstream materials(CAS) of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide: 111-49-9;91-13-4. |
| Q: What is the SMILES notation of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide? |
| A: SMILES notation of spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide is [Br-].c1ccc2c(c1)C[N+]1(CCCCCC1)C2. |
| Q: What is the Chinese name of 7463-07-2? |
| A: Chinese name of 7463-07-2 is 7463-07-2. |