spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide structure
|
Common Name | spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide | ||
|---|---|---|---|---|
| CAS Number | 7463-07-2 | Molecular Weight | 282.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | spiro[1,3-dihydroisoindol-2-ium-2,1'-azepan-1-ium],bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20BrN |
|---|---|
| Molecular Weight | 282.21900 |
| Exact Mass | 281.07800 |
| LogP | 0.05380 |
| InChIKey | OEIZYFXQQACXTK-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc2c(c1)C[N+]1(CCCCCC1)C2 |
|
~%
spiro[1,3-dihyd... CAS#:7463-07-2 |
| Literature: Blicke; Hotelling Journal of the American Chemical Society, 1954 , vol. 76, p. 5099,5100 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3,4,5,6,7-Hexahydro-spiro[azepin-1,2'-isoindolinium],Bromid |
| 2,3,4,5,6,7-hexahydro-spiro[azepine-1,2'-isoindolinium],bromide |