spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide
![spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide Structure](https://image.chemsrc.com/caspic/441/7463-08-3.png)
spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide structure
|
Common Name | spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide | ||
|---|---|---|---|---|
| CAS Number | 7463-08-3 | Molecular Weight | 296.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22BrN |
|---|---|
| Molecular Weight | 296.24600 |
| Exact Mass | 295.09400 |
| LogP | 0.44390 |
| InChIKey | OLVWSOZOPRDXQR-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc2c(c1)C[N+]1(CCCCCCC1)C2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
spiro[1,3-dihyd... CAS#:7463-08-3 |
| Literature: Blicke; Hotelling Journal of the American Chemical Society, 1954 , vol. 76, p. 5099,5100 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 7463-08-3? |
| A: Chinese name of 7463-08-3 is 7463-08-3. |
| Q: What is the SMILES notation of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide? |
| A: SMILES notation of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide is [Br-].c1ccc2c(c1)C[N+]1(CCCCCCC1)C2. |
| Q: What is the InChIKey of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide? |
| A: InChIKey of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide is OLVWSOZOPRDXQR-UHFFFAOYSA-M. |
| Q: What is the molecular formula of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide? |
| A: Molecular formula of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide is C15H22BrN. |
| Q: What is the English name of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide? |
| A: The English name of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide is spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide. |
| Q: What is the CAS number of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide? |
| A: CAS number of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide is 7463-08-3. |
| Q: What is the molecular weight of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide? |
| A: Molecular weight of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide is 296.24600. |
| Q: What are the upstream materials of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide? |
| A: Related upstream materials(CAS) of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide: 1121-92-2;91-13-4. |
| Q: What is the LogP of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide? |
| A: LogP of spiro[1,3-dihydroisoindol-2-ium-2,1'-azocan-1-ium],bromide is 0.44390. |