3,3-diethyl-10-methyl-3,7-diazoniaspiro[6.6]tridecane structure
|
Common Name | 3,3-diethyl-10-methyl-3,7-diazoniaspiro[6.6]tridecane | ||
|---|---|---|---|---|
| CAS Number | 7463-13-0 | Molecular Weight | 334.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H34BrN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-diethyl-11-methyl-3,7-diazoniaspiro[6.6]tridecane,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H34BrN2+ |
|---|---|
| Molecular Weight | 334.35900 |
| Exact Mass | 333.19100 |
| InChIKey | NWEIFOPRWJXUOH-UHFFFAOYSA-M |
| SMILES | CC[N+]1(CC)CCC[N+]2(CCCC(C)CC2)CC1.[Br-] |
|
~%
3,3-diethyl-10-... CAS#:7463-13-0 |
| Literature: Blicke; Hotelling Journal of the American Chemical Society, 1954 , vol. 76, p. 2427 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,3-diethyl-10-methyl-3,7-diazonia-spiro[6.6]tridecane,dibromide |
| 3,3-Diaethyl-10-methyl-3,7-diazonia-spiro[6.6]tridecan,Dibromid |