2-(Diphenylmethoxy)propanenitrile
2-(Diphenylmethoxy)propanenitrile structure
|
Common Name | 2-(Diphenylmethoxy)propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 74635-61-3 | Molecular Weight | 237.296 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 356.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C16H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.3±18.4 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Diphenylmethoxy)propanenitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 356.2±30.0 °C at 760 mmHg |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.296 |
| Flash Point | 150.3±18.4 °C |
| Exact Mass | 237.115356 |
| PSA | 33.02000 |
| LogP | 4.18 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | HCVOJPQEMAKKFV-NJZODYAQSA-N |
| SMILES | C=C1CC23CCC4C(C)(CCC(OC(=O)C(C)=CC)C4(C)C(=O)O)C2CCC1C3 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(Diphenylmethoxy)propanenitrile |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2-(Diphenylmethoxy)propanenitrile? |
| A: Boiling point of 2-(Diphenylmethoxy)propanenitrile is 356.2±30.0 °C at 760 mmHg. |
| Q: What is the English name of 2-(Diphenylmethoxy)propanenitrile? |
| A: The English name of 2-(Diphenylmethoxy)propanenitrile is 2-(Diphenylmethoxy)propanenitrile. |
| Q: What is the LogP of 2-(Diphenylmethoxy)propanenitrile? |
| A: LogP of 2-(Diphenylmethoxy)propanenitrile is 4.18. |
| Q: What is the InChIKey of 2-(Diphenylmethoxy)propanenitrile? |
| A: InChIKey of 2-(Diphenylmethoxy)propanenitrile is HCVOJPQEMAKKFV-NJZODYAQSA-N. |
| Q: What is the SMILES notation of 2-(Diphenylmethoxy)propanenitrile? |
| A: SMILES notation of 2-(Diphenylmethoxy)propanenitrile is C=C1CC23CCC4C(C)(CCC(OC(=O)C(C)=CC)C4(C)C(=O)O)C2CCC1C3. |
| Q: What is the CAS number of 2-(Diphenylmethoxy)propanenitrile? |
| A: CAS number of 2-(Diphenylmethoxy)propanenitrile is 74635-61-3. |
| Q: What English synonyms does 2-(Diphenylmethoxy)propanenitrile have? |
| A: English synonyms of 2-(Diphenylmethoxy)propanenitrile: 2-(Diphenylmethoxy)propanenitrile. |
| Q: What is the molecular weight of 2-(Diphenylmethoxy)propanenitrile? |
| A: Molecular weight of 2-(Diphenylmethoxy)propanenitrile is 237.296. |
| Q: What is the molecular formula of 2-(Diphenylmethoxy)propanenitrile? |
| A: Molecular formula of 2-(Diphenylmethoxy)propanenitrile is C16H15NO. |
| Q: What is the polar surface area (PSA) of 2-(Diphenylmethoxy)propanenitrile? |
| A: Polar surface area (PSA) of 2-(Diphenylmethoxy)propanenitrile is 33.02000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |