Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-)
Modify Date: 2025-08-28 20:57:39
Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-) structure
|
Common Name | Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-) | ||
|---|---|---|---|---|
| CAS Number | 74635-70-4 | Molecular Weight | 332.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H32O3 |
|---|---|
| Molecular Weight | 332.5 |
| InChIKey | LUNFPDFYIVVHLQ-OOPZRWPMSA-N |
| SMILES | C=C1CC23CCC4C(C)(C(=O)OC)CCCC4(C)C2CC(O)C1C3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-)? |
| A: Molecular formula of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-) is C21H32O3. |
| Q: What is the Chinese name of 74635-70-4? |
| A: Chinese name of 74635-70-4 is 74635-70-4. |
| Q: What is the molecular weight of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-)? |
| A: Molecular weight of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-) is 332.5. |
| Q: What is the CAS number of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-)? |
| A: CAS number of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-) is 74635-70-4. |
| Q: What is the SMILES notation of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-)? |
| A: SMILES notation of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-) is C=C1CC23CCC4C(C)(C(=O)OC)CCCC4(C)C2CC(O)C1C3. |
| Q: What is the English name of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-)? |
| A: The English name of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-) is Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-). |
| Q: What is the InChIKey of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-)? |
| A: InChIKey of Kaur-16-en-18-oic acid, 12-hydroxy-, methyl ester, (4I+/-,12I+/-) is LUNFPDFYIVVHLQ-OOPZRWPMSA-N. |