Benzamide,4-methoxy-N-(4-nitrophenyl)
Benzamide,4-methoxy-N-(4-nitrophenyl) structure
|
Common Name | Benzamide,4-methoxy-N-(4-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 7464-52-0 | Molecular Weight | 272.25600 | |
| Density | 1.333g/cm3 | Boiling Point | 377.3ºC at 760mmHg | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methoxy-N-(4-nitrophenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 377.3ºC at 760mmHg |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.25600 |
| Flash Point | 182ºC |
| Exact Mass | 272.08000 |
| PSA | 84.15000 |
| LogP | 3.45190 |
| Index of Refraction | 1.645 |
| InChIKey | ILPFMFNLPIBAJF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:3424-93-9
CAS#:586-78-7
CAS#:98-95-3
CAS#:100-01-6
CAS#:100-09-4
CAS#:123-11-5
CAS#:38968-72-8
CAS#:1516-60-5
CAS#:100-07-2
CAS#:61166-15-2This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Methoxy-4'-nitrobenzanilide |
| 4-Methoxy-benzoesaeure-<4-nitro-anilid> |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 4-methoxy-N-(4-nitrophenyl)benzamide? |
| A: Boiling point of 4-methoxy-N-(4-nitrophenyl)benzamide is 377.3ºC at 760mmHg. |
| Q: What is the LogP of 4-methoxy-N-(4-nitrophenyl)benzamide? |
| A: LogP of 4-methoxy-N-(4-nitrophenyl)benzamide is 3.45190. |
| Q: What are the upstream materials of 4-methoxy-N-(4-nitrophenyl)benzamide? |
| A: Related upstream materials(CAS) of 4-methoxy-N-(4-nitrophenyl)benzamide: 3424-93-9;586-78-7;98-95-3;100-01-6;100-09-4;123-11-5;38968-72-8;1516-60-5;100-07-2;61166-15-2. |
| Q: What is the molecular formula of 4-methoxy-N-(4-nitrophenyl)benzamide? |
| A: Molecular formula of 4-methoxy-N-(4-nitrophenyl)benzamide is C14H12N2O4. |
| Q: What English synonyms does 4-methoxy-N-(4-nitrophenyl)benzamide have? |
| A: English synonyms of 4-methoxy-N-(4-nitrophenyl)benzamide: 4-Methoxy-4'-nitrobenzanilide, 4-Methoxy-benzoesaeure-. |
| Q: What is the molecular weight of 4-methoxy-N-(4-nitrophenyl)benzamide? |
| A: Molecular weight of 4-methoxy-N-(4-nitrophenyl)benzamide is 272.25600. |
| Q: What is the SMILES notation of 4-methoxy-N-(4-nitrophenyl)benzamide? |
| A: SMILES notation of 4-methoxy-N-(4-nitrophenyl)benzamide is COc1ccc(C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1. |
| Q: What is the English name of 4-methoxy-N-(4-nitrophenyl)benzamide? |
| A: The English name of 4-methoxy-N-(4-nitrophenyl)benzamide is 4-methoxy-N-(4-nitrophenyl)benzamide. |
| Q: What is the polar surface area (PSA) of 4-methoxy-N-(4-nitrophenyl)benzamide? |
| A: Polar surface area (PSA) of 4-methoxy-N-(4-nitrophenyl)benzamide is 84.15000. |
| Q: What is the CAS number of 4-methoxy-N-(4-nitrophenyl)benzamide? |
| A: CAS number of 4-methoxy-N-(4-nitrophenyl)benzamide is 7464-52-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |