1,3-Benzenediol,1,3-bis(4-methylbenzenesulfonate) structure
|
Common Name | 1,3-Benzenediol,1,3-bis(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 7464-60-0 | Molecular Weight | 418.48300 | |
| Density | 1.352g/cm3 | Boiling Point | 593.8ºC at 760 mmHg | |
| Molecular Formula | C20H18O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.9ºC | |
| Name | [3-(4-methylphenyl)sulfonyloxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 593.8ºC at 760 mmHg |
| Molecular Formula | C20H18O6S2 |
| Molecular Weight | 418.48300 |
| Flash Point | 312.9ºC |
| Exact Mass | 418.05400 |
| PSA | 103.50000 |
| LogP | 6.00040 |
| Index of Refraction | 1.605 |
| InChIKey | TUQJPGPHFOXOIA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc(OS(=O)(=O)c3ccc(C)cc3)c2)cc1 |
|
~%
1,3-Benzenediol... CAS#:7464-60-0 |
| Literature: Bucherer; Hoffmann Journal fuer Praktische Chemie (Leipzig), 1929 , vol. <2>121, p. 121,123,138,141 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Resorcinol,di-p-toluene-sulfonate |
| ditosylate of resorcinol |
| 1,3-phenylene bistosylate |