bis(4-methoxy-3-nitro-phenyl)arsinic acid structure
|
Common Name | bis(4-methoxy-3-nitro-phenyl)arsinic acid | ||
|---|---|---|---|---|
| CAS Number | 7464-64-4 | Molecular Weight | 412.18300 | |
| Density | N/A | Boiling Point | 644.2ºC at 760 mmHg | |
| Molecular Formula | C14H13AsN2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.4ºC | |
| Name | bis(4-methoxy-3-nitrophenyl)arsinic acid |
|---|
| Boiling Point | 644.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H13AsN2O8 |
| Molecular Weight | 412.18300 |
| Flash Point | 343.4ºC |
| Exact Mass | 411.98900 |
| PSA | 147.40000 |
| LogP | 1.54580 |
| InChIKey | FPQRQDJDHQMVFR-UHFFFAOYSA-N |
| SMILES | COc1ccc([As](=O)(O)c2ccc(OC)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
|
~%
bis(4-methoxy-3... CAS#:7464-64-4 |
| Literature: Blicke; Oneto; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 925 |
|
~%
bis(4-methoxy-3... CAS#:7464-64-4 |
| Literature: Blicke; Oneto; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 925 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |