Phenol,4,4'-(bromoarsylene)bis[2-nitro- (8CI) structure
|
Common Name | Phenol,4,4'-(bromoarsylene)bis[2-nitro- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 7464-66-6 | Molecular Weight | 431.02700 | |
| Density | N/A | Boiling Point | 495.3ºC at 760mmHg | |
| Molecular Formula | C12H8AsBrN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.3ºC | |
| Name | 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol |
|---|
| Boiling Point | 495.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H8AsBrN2O6 |
| Molecular Weight | 431.02700 |
| Flash Point | 253.3ºC |
| Exact Mass | 429.87800 |
| PSA | 132.10000 |
| LogP | 2.46120 |
| InChIKey | OMJNTTGUVBGBLD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([As](Br)c2ccc(O)c([N+](=O)[O-])c2)ccc1O |
|
~%
Phenol,4,4'-(br... CAS#:7464-66-6 |
| Literature: Blicke; Oneto; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 925 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |