Phenol,4,4'-(bromoarsylene)bis[2-nitro- (8CI)
Phenol,4,4'-(bromoarsylene)bis[2-nitro- (8CI) structure
|
Common Name | Phenol,4,4'-(bromoarsylene)bis[2-nitro- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 7464-66-6 | Molecular Weight | 431.02700 | |
| Density | N/A | Boiling Point | 495.3ºC at 760mmHg | |
| Molecular Formula | C12H8AsBrN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 495.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H8AsBrN2O6 |
| Molecular Weight | 431.02700 |
| Flash Point | 253.3ºC |
| Exact Mass | 429.87800 |
| PSA | 132.10000 |
| LogP | 2.46120 |
| InChIKey | OMJNTTGUVBGBLD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([As](Br)c2ccc(O)c([N+](=O)[O-])c2)ccc1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Phenol,4,4'-(br... CAS#:7464-66-6 |
| Literature: Blicke; Oneto; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 925 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol? |
| A: Polar surface area (PSA) of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol is 132.10000. |
| Q: What is the CAS number of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol? |
| A: CAS number of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol is 7464-66-6. |
| Q: What is the English name of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol? |
| A: The English name of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol is 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol. |
| Q: What is the Chinese name of 7464-66-6? |
| A: Chinese name of 7464-66-6 is 7464-66-6. |
| Q: What are the upstream materials of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol? |
| A: Related upstream materials(CAS) of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol: 861788-34-3. |
| Q: What is the molecular formula of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol? |
| A: Molecular formula of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol is C12H8AsBrN2O6. |
| Q: What is the molecular weight of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol? |
| A: Molecular weight of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol is 431.02700. |
| Q: What is the LogP of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol? |
| A: LogP of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol is 2.46120. |
| Q: What is the InChIKey of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol? |
| A: InChIKey of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol is OMJNTTGUVBGBLD-UHFFFAOYSA-N. |
| Q: What is the boiling point of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol? |
| A: Boiling point of 4-[bromo-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol is 495.3ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |