3-ethyl-1,7-dimethyl-purine-2,6-dione structure
|
Common Name | 3-ethyl-1,7-dimethyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7464-74-6 | Molecular Weight | 208.21700 | |
| Density | 1.39g/cm3 | Boiling Point | 420.9ºC at 760 mmHg | |
| Molecular Formula | C9H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.4ºC | |
| Name | 3-ethyl-1,7-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 420.9ºC at 760 mmHg |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.21700 |
| Flash Point | 208.4ºC |
| Exact Mass | 208.09600 |
| PSA | 61.82000 |
| Index of Refraction | 1.656 |
| InChIKey | KHZSLIYYSMHPLX-UHFFFAOYSA-N |
| SMILES | CCn1c(=O)n(C)c(=O)c2c1ncn2C |
|
~%
3-ethyl-1,7-dim... CAS#:7464-74-6 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3653 |
|
~%
3-ethyl-1,7-dim... CAS#:7464-74-6 |
| Literature: Kowalska, Alicja; Maslankiewicz, Andrzej; Syrek, Barbara; Cieplinski, Piotr Monatshefte fuer Chemie, 1985 , vol. 116, p. 341 - 352 |
|
~%
3-ethyl-1,7-dim... CAS#:7464-74-6 |
| Literature: Kowalska, Alicja; Maslankiewicz, Andrzej; Syrek, Barbara; Cieplinski, Piotr Monatshefte fuer Chemie, 1985 , vol. 116, p. 341 - 352 |
|
~%
3-ethyl-1,7-dim... CAS#:7464-74-6 |
| Literature: Kowalska, Alicja; Maslankiewicz, Andrzej; Syrek, Barbara; Cieplinski, Piotr Monatshefte fuer Chemie, 1985 , vol. 116, p. 341 - 352 |
| 3-Ethyl-1,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
| 3-ethyl-1,7-dimethyl-3,7-dihydro-purine-2,6-dione |
| 3-ethylparaxanthine |
| 3-Aethyl-1,7-dimethyl-3,7-dihydro-purin-2,6-dion |
| Theobromine ethyl |
| 3-ethyl-1,7-dimethyl-purine-2,6-dione |