1,7-dimethyl-3-prop-2-enyl-purine-2,6-dione
1,7-dimethyl-3-prop-2-enyl-purine-2,6-dione structure
|
Common Name | 1,7-dimethyl-3-prop-2-enyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7464-75-7 | Molecular Weight | 220.22800 | |
| Density | 1.32g/cm3 | Boiling Point | 431.8ºC at 760 mmHg | |
| Molecular Formula | C10H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
Summary: 1,7-Dimethyl-3-prop-2-enylpurine-2,6-dione (Chinese name: 1,7-二甲基-3-丙-2-烯基嘌呤-2,6-二酮, CAS number: 7464-75-7, molecular formula: C10H12N4O2, molecular weight: 220.22800) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 431.8ºC at 760 mmHg |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.22800 |
| Flash Point | 214.9ºC |
| Exact Mass | 220.09600 |
| PSA | 61.82000 |
| Index of Refraction | 1.638 |
| InChIKey | KCMBMNCXMGNSAC-UHFFFAOYSA-N |
| SMILES | C=CCn1c(=O)n(C)c(=O)c2c1ncn2C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,7-dimethyl-3-... CAS#:7464-75-7 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3653 |
|
~%
1,7-dimethyl-3-... CAS#:7464-75-7 |
| Literature: Kowalska, Alicja; Maslankiewicz, Andrzej; Syrek, Barbara; Cieplinski, Piotr Monatshefte fuer Chemie, 1985 , vol. 116, p. 341 - 352 |
|
~%
1,7-dimethyl-3-... CAS#:7464-75-7 |
| Literature: Kowalska, Alicja; Maslankiewicz, Andrzej; Syrek, Barbara; Cieplinski, Piotr Monatshefte fuer Chemie, 1985 , vol. 116, p. 341 - 352 |
|
~%
1,7-dimethyl-3-... CAS#:7464-75-7 |
| Literature: Searle and Co. Patent: US2673848 , 1951 ; |
|
~%
1,7-dimethyl-3-... CAS#:7464-75-7 |
| Literature: Searle and Co. Patent: US2673848 , 1951 ; |
|
~%
1,7-dimethyl-3-... CAS#:7464-75-7 |
| Literature: Kowalska, Alicja; Maslankiewicz, Andrzej; Syrek, Barbara; Cieplinski, Piotr Monatshefte fuer Chemie, 1985 , vol. 116, p. 341 - 352 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-allyl-1,7-dimethyl-3,7-dihydro-purine-2,6-dione |
| 3-Allyl-1,7-dimethyl-3,7-dihydro-purin-2,6-dion |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione? |
| A: Molecular weight of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione is 220.22800. |
| Q: What is the InChIKey of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione? |
| A: InChIKey of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione is KCMBMNCXMGNSAC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione? |
| A: SMILES notation of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione is C=CCn1c(=O)n(C)c(=O)c2c1ncn2C. |
| Q: What is the English name of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione? |
| A: The English name of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione is 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione. |
| Q: What are the upstream materials of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione? |
| A: Related upstream materials(CAS) of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione: 611-59-6;106-95-6;2273-93-0;7052-53-1;72117-81-8;77-78-1. |
| Q: What is the molecular formula of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione? |
| A: Molecular formula of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione is C10H12N4O2. |
| Q: What is the Chinese name of 7464-75-7? |
| A: Chinese name of 7464-75-7 is 7464-75-7. |
| Q: What is the CAS number of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione? |
| A: CAS number of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione is 7464-75-7. |
| Q: What is the boiling point of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione? |
| A: Boiling point of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione is 431.8ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione? |
| A: Polar surface area (PSA) of 1,7-dimethyl-3-prop-2-enylpurine-2,6-dione is 61.82000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |