1,7-dimethyl-3-propan-2-yl-purine-2,6-dione structure
|
Common Name | 1,7-dimethyl-3-propan-2-yl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7464-77-9 | Molecular Weight | 222.24400 | |
| Density | 1.34g/cm3 | Boiling Point | 418.4ºC at 760 mmHg | |
| Molecular Formula | C10H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.9ºC | |
| Name | 1,7-dimethyl-3-propan-2-ylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 418.4ºC at 760 mmHg |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.24400 |
| Flash Point | 206.9ºC |
| Exact Mass | 222.11200 |
| PSA | 61.82000 |
| LogP | 0.01460 |
| Index of Refraction | 1.64 |
| InChIKey | OEYKVJDOZVMUAY-UHFFFAOYSA-N |
| SMILES | CC(C)n1c(=O)n(C)c(=O)c2c1ncn2C |
|
~%
1,7-dimethyl-3-... CAS#:7464-77-9 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3653 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-isopropyl-1,7-dimethyl-3,7-dihydro-purine-2,6-dione |
| 3-Isopropyl-1,7-dimethyl-3,7-dihydro-purin-2,6-dion |