1H-Purine-2,6-dione,3-butyl-3,7-dihydro-1,7-dimethyl- structure
|
Common Name | 1H-Purine-2,6-dione,3-butyl-3,7-dihydro-1,7-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 7464-82-6 | Molecular Weight | 236.27000 | |
| Density | 1.29g/cm3 | Boiling Point | 434.5ºC at 760mmHg | |
| Molecular Formula | C11H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.6ºC | |
| Name | 3-butyl-1,7-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 434.5ºC at 760mmHg |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27000 |
| Flash Point | 216.6ºC |
| Exact Mass | 236.12700 |
| PSA | 61.82000 |
| LogP | 0.23380 |
| Index of Refraction | 1.624 |
| InChIKey | LDYDPOMEZGHKTD-UHFFFAOYSA-N |
| SMILES | CCCCn1c(=O)n(C)c(=O)c2c1ncn2C |
|
~%
1H-Purine-2,6-d... CAS#:7464-82-6 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3653 |
|
~%
1H-Purine-2,6-d... CAS#:7464-82-6 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3653 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Butyl-1,7-dimethyl-3,7-dihydro-purin-2,6-dion |
| 3-butyl-1,7-dimethyl-3,7-dihydro-purine-2,6-dione |