N-Methyl-N-nitroso-2-phenylglycin
N-Methyl-N-nitroso-2-phenylglycin structure
|
Common Name | N-Methyl-N-nitroso-2-phenylglycin | ||
|---|---|---|---|---|
| CAS Number | 74641-61-5 | Molecular Weight | 194.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-Methyl-N-nitroso-2-phenylglycin (CAS number: 74641-61-5, molecular formula: C9H10N2O3, molecular weight: 194.18700), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Methyl-N-nitroso-2-phenylglycin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10N2O3 |
|---|---|
| Molecular Weight | 194.18700 |
| Exact Mass | 194.06900 |
| PSA | 69.97000 |
| LogP | 1.42550 |
| InChIKey | BFXCUDKQFWIPJP-UHFFFAOYSA-N |
| SMILES | CN(N=O)C(C(=O)O)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:35431-71-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-Methyl-N-nitroso-2-phenylglycin? |
| A: The English name of N-Methyl-N-nitroso-2-phenylglycin is N-Methyl-N-nitroso-2-phenylglycin. |
| Q: What is the CAS number of N-Methyl-N-nitroso-2-phenylglycin? |
| A: CAS number of N-Methyl-N-nitroso-2-phenylglycin is 74641-61-5. |
| Q: What is the Chinese name of 74641-61-5? |
| A: Chinese name of 74641-61-5 is 74641-61-5. |
| Q: What is the molecular weight of N-Methyl-N-nitroso-2-phenylglycin? |
| A: Molecular weight of N-Methyl-N-nitroso-2-phenylglycin is 194.18700. |
| Q: What is the polar surface area (PSA) of N-Methyl-N-nitroso-2-phenylglycin? |
| A: Polar surface area (PSA) of N-Methyl-N-nitroso-2-phenylglycin is 69.97000. |
| Q: What is the molecular formula of N-Methyl-N-nitroso-2-phenylglycin? |
| A: Molecular formula of N-Methyl-N-nitroso-2-phenylglycin is C9H10N2O3. |
| Q: What is the LogP of N-Methyl-N-nitroso-2-phenylglycin? |
| A: LogP of N-Methyl-N-nitroso-2-phenylglycin is 1.42550. |
| Q: What are the downstream products of N-Methyl-N-nitroso-2-phenylglycin? |
| A: Related downstream products(CAS) of N-Methyl-N-nitroso-2-phenylglycin: 35431-71-1. |
| Q: What is the InChIKey of N-Methyl-N-nitroso-2-phenylglycin? |
| A: InChIKey of N-Methyl-N-nitroso-2-phenylglycin is BFXCUDKQFWIPJP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-Methyl-N-nitroso-2-phenylglycin? |
| A: SMILES notation of N-Methyl-N-nitroso-2-phenylglycin is CN(N=O)C(C(=O)O)c1ccccc1. |