1,3-dimethyl-9-propyl-8-sulfanylidene-7H-purine-2,6-dione structure
|
Common Name | 1,3-dimethyl-9-propyl-8-sulfanylidene-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7465-06-7 | Molecular Weight | 254.30900 | |
| Density | 1.44g/cm3 | Boiling Point | 331.3ºC at 760 mmHg | |
| Molecular Formula | C10H14N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.2ºC | |
| Name | 1,3-dimethyl-9-propyl-8-sulfanylidene-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 331.3ºC at 760 mmHg |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.30900 |
| Flash Point | 154.2ºC |
| Exact Mass | 254.08400 |
| PSA | 96.81000 |
| LogP | 0.50630 |
| Index of Refraction | 1.676 |
| InChIKey | XLCDSXWWBCDGNY-UHFFFAOYSA-N |
| SMILES | CCCn1c(=S)[nH]c2c(=O)n(C)c(=O)n(C)c21 |
|
~%
1,3-dimethyl-9-... CAS#:7465-06-7 |
| Literature: Blicke; Schaaf Journal of the American Chemical Society, 1956 , vol. 78, p. 5857,5860 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-dimethyl-9-propyl-8-thio-uric acid |
| 1,3-Dimethyl-9-propyl-8-thio-harnsaeure |