(2-methoxyphenyl)-phenyl-arsinic acid structure
|
Common Name | (2-methoxyphenyl)-phenyl-arsinic acid | ||
|---|---|---|---|---|
| CAS Number | 7465-22-7 | Molecular Weight | 292.16200 | |
| Density | N/A | Boiling Point | 478.4ºC at 760 mmHg | |
| Molecular Formula | C13H13AsO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184ºC | |
| Name | (2-methoxyphenyl)-phenylarsinic acid |
|---|
| Boiling Point | 478.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H13AsO3 |
| Molecular Weight | 292.16200 |
| Flash Point | 184ºC |
| Exact Mass | 292.00800 |
| PSA | 46.53000 |
| LogP | 0.67440 |
| InChIKey | SKEANNXXOAWPJS-UHFFFAOYSA-N |
| SMILES | COc1ccccc1[As](=O)(O)c1ccccc1 |
|
~%
(2-methoxypheny... CAS#:7465-22-7 |
| Literature: Blicke; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 534 |
|
~%
(2-methoxypheny... CAS#:7465-22-7 |
| Literature: Blicke; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 534 |
|
~%
(2-methoxypheny... CAS#:7465-22-7 |
| Literature: Blicke; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 534 |