3,4-dimethyl-2-(phenylcarbamoyl)pentanoic acid structure
|
Common Name | 3,4-dimethyl-2-(phenylcarbamoyl)pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7465-34-1 | Molecular Weight | 249.30600 | |
| Density | 1.147g/cm3 | Boiling Point | 455.3ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.1ºC | |
| Name | 3,4-dimethyl-2-(phenylcarbamoyl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 455.3ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 229.1ºC |
| Exact Mass | 249.13600 |
| PSA | 66.40000 |
| LogP | 2.69100 |
| Index of Refraction | 1.555 |
| InChIKey | FJAKCKMHQAWIMY-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)C(C(=O)O)C(=O)Nc1ccccc1 |
|
~%
3,4-dimethyl-2-... CAS#:7465-34-1 |
| Literature: Blicke; Zinnes Journal of the American Chemical Society, 1955 , vol. 77, p. 5399 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(1,2-Dimethyl-propyl)-N-phenyl-malonamidsaeure |
| 2-(1,2-dimethyl-propyl)-N-phenyl-malonamic acid |