(4-ethylphenyl) 4-methoxybenzoate structure
|
Common Name | (4-ethylphenyl) 4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 7465-91-0 | Molecular Weight | 256.29600 | |
| Density | 1.115g/cm3 | Boiling Point | 391.4ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.1ºC | |
| Name | (4-ethylphenyl) 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 391.4ºC at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 165.1ºC |
| Exact Mass | 256.11000 |
| PSA | 35.53000 |
| LogP | 3.47680 |
| Index of Refraction | 1.558 |
| InChIKey | NEXDLSSYDDCZQY-UHFFFAOYSA-N |
| SMILES | CCc1ccc(OC(=O)c2ccc(OC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~96%
(4-ethylphenyl)... CAS#:7465-91-0 |
| Literature: Meng, Jing-Jing; Gao, Min; Wei, Yu-Ping; Zhang, Wen-Qin Chemistry - An Asian Journal, 2012 , vol. 7, # 5 p. 872 - 875 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Ethylphenyl 4-methoxybenzoate |