2-(3,5-dibromopyridin-1-yl)-1-(4-methoxyphenyl)ethanone structure
|
Common Name | 2-(3,5-dibromopyridin-1-yl)-1-(4-methoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 7466-78-6 | Molecular Weight | 465.96300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12Br3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,5-dibromopyridin-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12Br3NO2 |
|---|---|
| Molecular Weight | 465.96300 |
| Exact Mass | 462.84200 |
| PSA | 30.18000 |
| LogP | 0.39460 |
| InChIKey | GNCBRVILNPQNDD-UHFFFAOYSA-M |
| SMILES | COc1ccc(C(=O)C[n+]2cc(Br)cc(Br)c2)cc1.[Br-] |
| HS Code | 2933399090 |
|---|
|
~%
2-(3,5-dibromop... CAS#:7466-78-6 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-dibromo-1-(4-methoxy-phenacyl)-pyridinium,bromide |
| 3,5-Dibrom-1-(4-methoxy-phenacyl)-pyridinium,Bromid |
| 2-(3,5-DIBROMOPYRIDIN-1-IUM-1-YL)-1-(4-METHOXYPHENYL)ETHANONE BROMIDE |