1-(4-fluorophenyl)-2-[2-(3-hydroxypropyl)-2H-pyridin-1-yl]ethanone structure
|
Common Name | 1-(4-fluorophenyl)-2-[2-(3-hydroxypropyl)-2H-pyridin-1-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 7466-83-3 | Molecular Weight | 354.21400 | |
| Density | 1.162g/cm3 | Boiling Point | 454.5ºC at 760 mmHg | |
| Molecular Formula | C16H17BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.7ºC | |
| Name | 1-(4-fluorophenyl)-2-[2-(3-hydroxypropyl)pyridin-1-ium-1-yl]ethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 454.5ºC at 760 mmHg |
| Molecular Formula | C16H17BrFNO2 |
| Molecular Weight | 354.21400 |
| Flash Point | 228.7ºC |
| Exact Mass | 353.04300 |
| PSA | 41.18000 |
| Index of Refraction | 1.551 |
| InChIKey | SELTYGLVQYMBDD-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccccc1CCCO)c1ccc(F)cc1.[Br-] |
|
~%
1-(4-fluorophen... CAS#:7466-83-3 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 3960 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(4-FLUOROPHENYL)-2-[2-(3-HYDROXYPROPYL)PYRIDIN-1-IUM-1-YL]ETHANONE BROMIDE |
| 1-(4-Fluor-phenacyl)-2-(3-hydroxy-propyl)-pyridinium,Bromid |
| 1-(4-fluoro-phenacyl)-2-(3-hydroxy-propyl)-pyridinium,bromide |