3-(4-chlorophenyl)-2-phenyl-prop-2-enoic acid
Modify Date: 2025-08-27 14:23:48
3-(4-chlorophenyl)-2-phenyl-prop-2-enoic acid structure
|
Common Name | 3-(4-chlorophenyl)-2-phenyl-prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 7466-99-1 | Molecular Weight | 258.70000 | |
| Density | 1.299g/cm3 | Boiling Point | 371.4ºC at 760 mmHg | |
| Molecular Formula | C15H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.4ºC | |
| Name | 4-CHLORO-(α-PHENYL)-CINNAMIC ACID |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 371.4ºC at 760 mmHg |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70000 |
| Flash Point | 178.4ºC |
| Exact Mass | 258.04500 |
| PSA | 37.30000 |
| LogP | 3.96520 |
| Index of Refraction | 1.658 |
| InChIKey | VRWKAXRIXMCDDY-GXDHUFHOSA-N |
| SMILES | O=C(O)C(=Cc1ccc(Cl)cc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (E)-2-phenyl-3-(4-chlorophenyl)acrylic acid |
| (E)-3-(4-chlorophenyl)-2-phenylpropenoic acid |
| trans-3-<4-Chlor-phenyl>-2-phenyl-acrylsaeure |
| 2-phenyl-3-(4-chlorophenyl)propenoic acid |
| (2E)-3-(4-chlorophenyl)-2-phenylacrylic acid |