4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid
Modify Date: 2026-07-06 21:08:34
![4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/046/746673-84-7.png)
4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid structure
|
Common Name | 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 746673-84-7 | Molecular Weight | 281.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11N5O2 |
|---|---|
| Molecular Weight | 281.27 |
| InChIKey | QRSNZWDAAYCTQZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ncnc(Nc3ccccc3)n2)c[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 746673-84-7? |
| A: Chinese name of 746673-84-7 is 746673-84-7. |
| Q: What is the molecular weight of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid? |
| A: Molecular weight of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid is 281.27. |
| Q: What is the molecular formula of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid? |
| A: Molecular formula of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid is C14H11N5O2. |
| Q: What is the SMILES notation of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid? |
| A: SMILES notation of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid is O=C(O)c1cc(-c2ncnc(Nc3ccccc3)n2)c[nH]1. |
| Q: What is the English name of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid? |
| A: The English name of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid is 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid. |
| Q: What is the CAS number of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid? |
| A: CAS number of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid is 746673-84-7. |
| Q: What is the InChIKey of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid? |
| A: InChIKey of 4-(4-Phenylamino-[1,3,5]triazin-2-yl)-1H-pyrrole-2-carboxylic acid is QRSNZWDAAYCTQZ-UHFFFAOYSA-N. |