Benzoicacid, 4-nitro-, 2-(1-methyl-3-oxobutylidene)hydrazide structure
|
Common Name | Benzoicacid, 4-nitro-, 2-(1-methyl-3-oxobutylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 7467-43-8 | Molecular Weight | 263.24900 | |
| Density | 1.28g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-N-[(Z)-4-oxopentan-2-ylideneamino]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.24900 |
| Exact Mass | 263.09100 |
| PSA | 104.35000 |
| LogP | 2.59370 |
| Index of Refraction | 1.582 |
| InChIKey | SHTJLYCRAHBIKA-JYRVWZFOSA-N |
| SMILES | CC(=O)CC(C)=NNC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
Benzoicacid, 4-... CAS#:7467-43-8 |
| Literature: Chen Journal of the Chinese Chemical Society (Peking), 1935 , vol. 3, p. 251,253 |
|
~%
Benzoicacid, 4-... CAS#:7467-43-8 |
| Literature: Chen Journal of the Chinese Chemical Society (Peking), 1935 , vol. 3, p. 251,253 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-benzoesaeure-(1-methyl-3-oxo-butylidenhydrazid) |
| 4-nitro-benzoic acid-(1-methyl-3-oxo-butylidenehydrazide) |
| 4-nitro-N'-[(2Z)-4-oxopentan-2-ylidene]benzohydrazide |