N-(5-chloro-6-methoxy-quinolin-8-yl)-N-propan-2-yl-pentane-1,5-diamine
N-(5-chloro-6-methoxy-quinolin-8-yl)-N-propan-2-yl-pentane-1,5-diamine structure
|
Common Name | N-(5-chloro-6-methoxy-quinolin-8-yl)-N-propan-2-yl-pentane-1,5-diamine | ||
|---|---|---|---|---|
| CAS Number | 7467-66-5 | Molecular Weight | 335.87200 | |
| Density | 1.131g/cm3 | Boiling Point | 504ºC at 760 mmHg | |
| Molecular Formula | C18H26ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 504ºC at 760 mmHg |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.87200 |
| Flash Point | 258.6ºC |
| Exact Mass | 335.17600 |
| PSA | 46.18000 |
| LogP | 4.94090 |
| Index of Refraction | 1.583 |
| InChIKey | PZTUPXDSJRFMKO-UHFFFAOYSA-N |
| SMILES | COc1cc(NCCCCCNC(C)C)c2ncccc2c1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(5-chloro-6-methoxy-[8]quinolyl)-N'-isopropyl-pentanediyldiamine |
| N-(5-Chlor-6-methoxy-[8]chinolyl)-N'-isopropyl-pentandiyldiamin |
| 1-{[benzyl(5-chloro-2-hydroxy-3-methylbenzyl)amino]methyl}naphthalen-2-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin? |
| A: Polar surface area (PSA) of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin is 46.18000. |
| Q: What English synonyms does N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin have? |
| A: English synonyms of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin: N-(5-chloro-6-methoxy-[8]quinolyl)-N'-isopropyl-pentanediyldiamine, N-(5-Chlor-6-methoxy-[8]chinolyl)-N'-isopropyl-pentandiyldiamin, 1-{[benzyl(5-chloro-2-hydroxy-3-methylbenzyl)amino]methyl}naphthalen-2-ol. |
| Q: What is the molecular formula of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin? |
| A: Molecular formula of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin is C18H26ClN3O. |
| Q: What is the LogP of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin? |
| A: LogP of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin is 4.94090. |
| Q: What is the Chinese name of 7467-66-5? |
| A: Chinese name of 7467-66-5 is 7467-66-5. |
| Q: What are the upstream materials of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin? |
| A: Related upstream materials(CAS) of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin: 86-78-2. |
| Q: What is the CAS number of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin? |
| A: CAS number of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin is 7467-66-5. |
| Q: What is the InChIKey of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin? |
| A: InChIKey of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin is PZTUPXDSJRFMKO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin? |
| A: Molecular weight of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin is 335.87200. |
| Q: What is the SMILES notation of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin? |
| A: SMILES notation of N-(5-Chlor-2-hydroxy-3-methyl-benzyl)-N-(2-hydroxy-naphthyl-(1)-methyl)-benzylamin is COc1cc(NCCCCCNC(C)C)c2ncccc2c1Cl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |