1H-Pyrrole-2,5-dicarboxylicacid, 3-ethyl-4-methyl-, 2,5-diethyl ester structure
|
Common Name | 1H-Pyrrole-2,5-dicarboxylicacid, 3-ethyl-4-methyl-, 2,5-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7467-77-8 | Molecular Weight | 253.29400 | |
| Density | 1.122g/cm3 | Boiling Point | 390.8ºC at 760mmHg | |
| Molecular Formula | C13H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.1ºC | |
| Name | diethyl 3-ethyl-4-methyl-1H-pyrrole-2,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 390.8ºC at 760mmHg |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.29400 |
| Flash Point | 190.1ºC |
| Exact Mass | 253.13100 |
| PSA | 68.39000 |
| LogP | 2.23890 |
| Index of Refraction | 1.513 |
| InChIKey | JIMWYFLOQANMML-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c(C(=O)OCC)c(CC)c1C |
|
~72%
1H-Pyrrole-2,5-... CAS#:7467-77-8 |
| Literature: Baciocchi, Enrico; Muraglia, Ester; Sleiter, Giancarlo Journal of Organic Chemistry, 1992 , vol. 57, # 8 p. 2486 - 2490 |
|
~%
1H-Pyrrole-2,5-... CAS#:7467-77-8 |
| Literature: Fischer et al. Justus Liebigs Annalen der Chemie, 1933 , vol. 500, p. 137,177 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Aethyl-4-methyl-pyrrol-2,5-dicarbonsaeure-diaethylester |
| 3-ethyl-4-methyl-pyrrole-2,5-dicarboxylic acid diethyl ester |
| diethyl 3-ethyl-4-methylpyrrole-2,5-dicarboxylate |
| 3-Ethyl-2,5-dicarbethoxy-4-methyl-pyrrol |