(4-chlorophenyl)-(3,4-diphenyloxazol-5-yl)methanone structure
|
Common Name | (4-chlorophenyl)-(3,4-diphenyloxazol-5-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 7467-85-8 | Molecular Weight | 359.80500 | |
| Density | 1.257g/cm3 | Boiling Point | 561ºC at 760 mmHg | |
| Molecular Formula | C22H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.1ºC | |
| Name | (4-chlorophenyl)-(3,4-diphenyl-1,2-oxazol-5-yl)methanone |
|---|
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 561ºC at 760 mmHg |
| Molecular Formula | C22H14ClNO2 |
| Molecular Weight | 359.80500 |
| Flash Point | 293.1ºC |
| Exact Mass | 359.07100 |
| PSA | 43.10000 |
| LogP | 5.89300 |
| Index of Refraction | 1.62 |
| InChIKey | MQEVCGJFVFAQNO-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1onc(-c2ccccc2)c1-c1ccccc1 |
|
~%
(4-chlorophenyl... CAS#:7467-85-8 |
| Literature: Kohler, Bickel Journal of the American Chemical Society, 1930 , vol. 52, p. 4943,4948 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |