1H-Pyrrole-2-carboxamide,4-[[[4-[[2-[(aminoiminomethyl)amino]acetyl]amino]-1-methyl-1H-pyrrol-2-yl]carbonyl]amino]-N-[5-[[(3-amino-3-iminopropyl)amino]carbonyl]-1-methyl-1H-pyrrol-3-yl]-1-methyl-,hydr structure
|
Common Name | 1H-Pyrrole-2-carboxamide,4-[[[4-[[2-[(aminoiminomethyl)amino]acetyl]amino]-1-methyl-1H-pyrrol-2-yl]carbonyl]amino]-N-[5-[[(3-amino-3-iminopropyl)amino]carbonyl]-1-methyl-1H-pyrrol-3-yl]-1-methyl-,hydr | ||
|---|---|---|---|---|
| CAS Number | 74671-13-9 | Molecular Weight | 589.05000 | |
| Density | 1.52g/cm3 | Boiling Point | 806.8ºC at 760 mmHg | |
| Molecular Formula | C24H33ClN12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 441.8ºC | |
| Name | N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrole-2-carboxamide,hydrochloride |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 806.8ºC at 760 mmHg |
| Molecular Formula | C24H33ClN12O4 |
| Molecular Weight | 589.05000 |
| Flash Point | 441.8ºC |
| Exact Mass | 588.24400 |
| PSA | 242.96000 |
| LogP | 3.08700 |
| Index of Refraction | 1.72 |
| InChIKey | WMUFVOWESCBEEC-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Cn1cc(NC(=O)c2cc(NC(=O)c3cc(NC(=O)CN=C(N)N)cn3C)cn2C)cc1C(=O)NCCC(=N)N |
|
~%
1H-Pyrrole-2-ca... CAS#:74671-13-9 |
| Literature: Bialer, Meir; Yagen, Boris; Mechoulam, Raphael; Becker, Yechiel Journal of Medicinal Chemistry, 1980 , vol. 23, # 10 p. 1144 - 1148 |
|
~%
1H-Pyrrole-2-ca... CAS#:74671-13-9 |
| Literature: Bialer, Meir; Yagen, Boris; Mechoulam, Raphael; Becker, Yechiel Journal of Medicinal Chemistry, 1980 , vol. 23, # 10 p. 1144 - 1148 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |