8-chloro-3-ethyl-1,7-dimethyl-purine-2,6-dione structure
|
Common Name | 8-chloro-3-ethyl-1,7-dimethyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7468-66-8 | Molecular Weight | 242.66200 | |
| Density | 1.52g/cm3 | Boiling Point | 431.1ºC at 760 mmHg | |
| Molecular Formula | C9H11ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.5ºC | |
| Name | 8-chloro-3-ethyl-1,7-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 431.1ºC at 760 mmHg |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.66200 |
| Flash Point | 214.5ºC |
| Exact Mass | 242.05700 |
| PSA | 61.82000 |
| LogP | 0.10700 |
| Index of Refraction | 1.673 |
| InChIKey | NBZUCXMGFZGEHE-UHFFFAOYSA-N |
| SMILES | CCn1c(=O)n(C)c(=O)c2c1nc(Cl)n2C |
|
~%
8-chloro-3-ethy... CAS#:7468-66-8 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3655 |
|
~%
8-chloro-3-ethy... CAS#:7468-66-8 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3655 |
|
~%
8-chloro-3-ethy... CAS#:7468-66-8 |
| Literature: Biltz; Peukert Chemische Berichte, 1925 , vol. 58, p. 2191 |
| 3-Aethyl-8-chlor-1,7-dimethyl-3,7-dihydro-purin-2,6-dion |
| 3-ethyl-8-chloro-1,7-dimethyl-3,7-dihydro-purine-2,6-dione |