2-acetamido-3-phenyl-propanamide structure
|
Common Name | 2-acetamido-3-phenyl-propanamide | ||
|---|---|---|---|---|
| CAS Number | 7469-24-1 | Molecular Weight | 206.24100 | |
| Density | 1.152g/cm3 | Boiling Point | 503.1ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258ºC | |
| Name | 2-acetamido-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 503.1ºC at 760 mmHg |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24100 |
| Flash Point | 258ºC |
| Exact Mass | 206.10600 |
| PSA | 72.19000 |
| LogP | 1.31030 |
| Index of Refraction | 1.548 |
| InChIKey | LRSBEAVFLIKKIO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1ccccc1)C(N)=O |
| HS Code | 2924299090 |
|---|
|
~%
2-acetamido-3-p... CAS#:7469-24-1 |
| Literature: Lipshutz, Bruce H.; Hungate, Randall W.; NcCarthy, Keith E. Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7703 - 7713 |
|
~%
2-acetamido-3-p... CAS#:7469-24-1 |
| Literature: Lipshutz, Bruce H.; Hungate, Randall W.; NcCarthy, Keith E. Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7703 - 7713 |
|
~%
2-acetamido-3-p... CAS#:7469-24-1 |
| Literature: Siemion,I.Z.; Dzugaj,A. Roczniki Chemii, 1966 , vol. 40, p. 1699 - 1706 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(Acetylamino)-3-phenylpropanamide |
| 2-Acetamido-3-phenylpropionamide |
| Acetyl-dl-phenylalanin-amid |
| N-acetyl-DL-phenylalanine amide |
| N-Acetyl-DL-phenylalaninamid |
| 2-acetamido-3-phenyl-propanamide |
| N-acetylphenylalanine amide |
| N-Acetyl-phenylalanin-amid |