Methionine,N-[N-[(phenylmethyl)sulfonyl]-L-methionyl]-, ethyl ester (9CI) structure
|
Common Name | Methionine,N-[N-[(phenylmethyl)sulfonyl]-L-methionyl]-, ethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 7469-36-5 | Molecular Weight | 462.64700 | |
| Density | 1.244g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H30N2O5S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[[2-(benzylsulfonylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
|---|
| Density | 1.244g/cm3 |
|---|---|
| Molecular Formula | C19H30N2O5S3 |
| Molecular Weight | 462.64700 |
| Exact Mass | 462.13200 |
| PSA | 160.55000 |
| LogP | 3.89130 |
| Index of Refraction | 1.564 |
| InChIKey | LGHJDZOAVDCOSV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCSC)NC(=O)C(CCSC)NS(=O)(=O)Cc1ccccc1 |
|
~%
Methionine,N-[N... CAS#:7469-36-5 |
| Literature: Milne; Peng Journal of the American Chemical Society, 1957 , vol. 79, p. 639,642 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |