(2Z)-7-methoxy-2-(methoxymethylidene)-3,4-dihydrophenanthren-1-one structure
|
Common Name | (2Z)-7-methoxy-2-(methoxymethylidene)-3,4-dihydrophenanthren-1-one | ||
|---|---|---|---|---|
| CAS Number | 7469-45-6 | Molecular Weight | 268.30700 | |
| Density | 1.251g/cm3 | Boiling Point | 443.2ºC at 760 mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
| Name | 7-methoxy-2-(methoxymethylidene)-3,4-dihydrophenanthren-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 443.2ºC at 760 mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 213.8ºC |
| Exact Mass | 268.11000 |
| PSA | 35.53000 |
| LogP | 3.50760 |
| Index of Refraction | 1.672 |
| InChIKey | MICOFICETPMCPE-BENRWUELSA-N |
| SMILES | COC=C1CCc2c(ccc3cc(OC)ccc23)C1=O |
|
~%
(2Z)-7-methoxy-... CAS#:7469-45-6 |
| Literature: Johnson; Petersen; Gutsche Journal of the American Chemical Society, 1947 , vol. 69, p. 2942,2949 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7-Methoxy-2H-chromen-3-carbonsaeure |
| 7-Methoxy-2-methoxymethylen-3,4-dihydro-2H-phenanthren-1-on |
| acide methoxy-7 2H chromene carboxylique-3 |
| 7-methoxy-2-methoxymethylene-3,4-dihydro-2H-phenanthren-1-one |