2-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-1-methyl-2H-quinoline structure
|
Common Name | 2-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-1-methyl-2H-quinoline | ||
|---|---|---|---|---|
| CAS Number | 7469-64-9 | Molecular Weight | 461.33600 | |
| Density | 1.119g/cm3 | Boiling Point | 486.6ºC at 760 mmHg | |
| Molecular Formula | C22H24INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.7ºC | |
| Name | 2-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-1-methylquinolin-1-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 486.6ºC at 760 mmHg |
| Molecular Formula | C22H24INO2 |
| Molecular Weight | 461.33600 |
| Flash Point | 160.7ºC |
| Exact Mass | 461.08500 |
| PSA | 22.34000 |
| LogP | 1.63610 |
| Index of Refraction | 1.626 |
| InChIKey | LSYWKGFRELAVRR-RSGUCCNWSA-M |
| SMILES | CCOc1ccc(C=Cc2ccc3ccccc3[n+]2C)cc1OCC.[I-] |
|
~%
2-[(E)-2-(3,4-d... CAS#:7469-64-9 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3407 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Quinolinium,4-diethoxyphenyl)ethenyl)-,1-methyl-,iodide |