2-Naphthalenecarboxylicacid, 2-ethyl-1,2,3,4-tetrahydro-1-oxo-, methyl ester structure
|
Common Name | 2-Naphthalenecarboxylicacid, 2-ethyl-1,2,3,4-tetrahydro-1-oxo-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 7469-74-1 | Molecular Weight | 232.27500 | |
| Density | 1.125g/cm3 | Boiling Point | 335.3ºC at 760mmHg | |
| Molecular Formula | C14H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.2ºC | |
| Name | methyl 2-ethyl-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 335.3ºC at 760mmHg |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.27500 |
| Flash Point | 146.2ºC |
| Exact Mass | 232.11000 |
| PSA | 43.37000 |
| LogP | 2.38490 |
| Index of Refraction | 1.526 |
| InChIKey | MCTSXXIDKJVVPW-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)OC)CCc2ccccc2C1=O |
|
~%
2-Naphthaleneca... CAS#:7469-74-1 |
| Literature: Kloetzel; Close Journal of Organic Chemistry, 1946 , vol. 11, p. 395,397 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-ethyl-1-oxo-1,2,3,4-tetrahydro-[2]naphthoic acid methyl ester |
| 2-Aethyl-1-oxo-1,2,3,4-tetrahydro-[2]naphthoesaeure-methylester |