1,3-Dicyclohexyl-5-phenylbarbituric acid
1,3-Dicyclohexyl-5-phenylbarbituric acid structure
|
Common Name | 1,3-Dicyclohexyl-5-phenylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 747-79-5 | Molecular Weight | 368.46900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,3-Dicyclohexyl-5-phenylbarbituric acid (1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione), CAS号 747-79-5, molecular formula C22H28N2O3, molecular weight 368.46900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H28N2O3 |
|---|---|
| Molecular Weight | 368.46900 |
| Exact Mass | 368.21000 |
| PSA | 57.69000 |
| LogP | 4.10220 |
| InChIKey | VHHKYYKWQDTBFM-UHFFFAOYSA-N |
| SMILES | O=C1C(c2ccccc2)C(=O)N(C2CCCCC2)C(=O)N1C1CCCCC1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| BARBITURIC ACID,1,3-DICYCLOHEXYL-5-PHENYL |
| 1,3-Dicyclohexyl-5-phenylbarbituric acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 747-79-5? |
| A: Chinese name of 747-79-5 is 747-79-5. |
| Q: What English synonyms does 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione have? |
| A: English synonyms of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione: BARBITURIC ACID,1,3-DICYCLOHEXYL-5-PHENYL, 1,3-Dicyclohexyl-5-phenylbarbituric acid. |
| Q: What is the molecular weight of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione? |
| A: Molecular weight of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione is 368.46900. |
| Q: What is the LogP of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione? |
| A: LogP of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione is 4.10220. |
| Q: What is the English name of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione? |
| A: The English name of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione is 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione. |
| Q: What is the polar surface area (PSA) of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione? |
| A: Polar surface area (PSA) of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione is 57.69000. |
| Q: What is the molecular formula of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione? |
| A: Molecular formula of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione is C22H28N2O3. |
| Q: What is the InChIKey of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione? |
| A: InChIKey of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione is VHHKYYKWQDTBFM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione? |
| A: CAS number of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione is 747-79-5. |
| Q: What is the SMILES notation of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione? |
| A: SMILES notation of 1,3-dicyclohexyl-5-phenyl-1,3-diazinane-2,4,6-trione is O=C1C(c2ccccc2)C(=O)N(C2CCCCC2)C(=O)N1C1CCCCC1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |