Acetamide,N-(3-hydroxy-4-phenanthrenyl)- structure
|
Common Name | Acetamide,N-(3-hydroxy-4-phenanthrenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7470-18-0 | Molecular Weight | 251.28000 | |
| Density | 1.328g/cm3 | Boiling Point | 536.5ºC at 760 mmHg | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.3ºC | |
| Name | N-(3-hydroxyphenanthren-4-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 536.5ºC at 760 mmHg |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28000 |
| Flash Point | 278.3ºC |
| Exact Mass | 251.09500 |
| PSA | 49.33000 |
| LogP | 3.73000 |
| Index of Refraction | 1.763 |
| InChIKey | YGLWDUJLUNCYKV-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(O)ccc2ccc3ccccc3c12 |
| HS Code | 2924299090 |
|---|
|
~%
Acetamide,N-(3-... CAS#:7470-18-0 |
| Literature: Burger; Mosettig Journal of the American Chemical Society, 1934 , vol. 56, p. 1745 |
|
~%
Acetamide,N-(3-... CAS#:7470-18-0 |
| Literature: Juneja,T.R.; Dannenberg,H. Tetrahedron, 1975 , vol. 31, p. 695 - 700 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetamino-phenanthrol-(3) |
| Acetamide,N-(3-hydroxy-4-phenanthrenyl) |
| 4-Acetamino-3-phenanthrol |
| N-(3-hydroxy-[4]phenanthryl)-acetamide |