9(10H)-Anthracenone,1-methoxy-10,10-bis(4-methoxyphenyl)- structure
|
Common Name | 9(10H)-Anthracenone,1-methoxy-10,10-bis(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7470-28-2 | Molecular Weight | 436.49800 | |
| Density | 1.207g/cm3 | Boiling Point | 575.7ºC at 760 mmHg | |
| Molecular Formula | C29H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247ºC | |
| Name | 1-methoxy-10,10-bis(4-methoxyphenyl)anthracen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 575.7ºC at 760 mmHg |
| Molecular Formula | C29H24O4 |
| Molecular Weight | 436.49800 |
| Flash Point | 247ºC |
| Exact Mass | 436.16700 |
| PSA | 44.76000 |
| LogP | 5.63950 |
| Index of Refraction | 1.622 |
| InChIKey | BLIZVDASIRFOKB-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)c3ccccc3C(=O)c3c(OC)cccc32)cc1 |
|
~%
9(10H)-Anthrace... CAS#:7470-28-2 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1938 , vol. 60, p. 2642 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-methoxy-10,10-bis-(4-methoxy-phenyl)-anthrone |