Ethanone,1-[4-[2-(4-chlorophenyl)ethenyl]phenyl]-2-(1-piperidinyl)- structure
|
Common Name | Ethanone,1-[4-[2-(4-chlorophenyl)ethenyl]phenyl]-2-(1-piperidinyl)- | ||
|---|---|---|---|---|
| CAS Number | 7470-80-6 | Molecular Weight | 339.85800 | |
| Density | 1.173g/cm3 | Boiling Point | 503.8ºC at 760mmHg | |
| Molecular Formula | C21H22ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.5ºC | |
| Name | 1-[4-[2-(4-chlorophenyl)ethenyl]phenyl]-2-piperidin-1-ylethanone |
|---|
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 503.8ºC at 760mmHg |
| Molecular Formula | C21H22ClNO |
| Molecular Weight | 339.85800 |
| Flash Point | 258.5ºC |
| Exact Mass | 339.13900 |
| PSA | 20.31000 |
| LogP | 5.11690 |
| Index of Refraction | 1.631 |
| InChIKey | UOABAPJUJLLAFB-SNAWJCMRSA-N |
| SMILES | O=C(CN1CCCCC1)c1ccc(C=Cc2ccc(Cl)cc2)cc1 |
| HS Code | 2933399090 |
|---|
|
~%
Ethanone,1-[4-[... CAS#:7470-80-6 |
| Literature: Codington; Mosettig Journal of Organic Chemistry, 1952 , vol. 17, p. 1035,1040 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |