4-[[(E)-2-hydroxy-3-oxo-prop-1-enyl]amino]benzoic acid structure
|
Common Name | 4-[[(E)-2-hydroxy-3-oxo-prop-1-enyl]amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 7470-83-9 | Molecular Weight | 207.18300 | |
| Density | 1.452g/cm3 | Boiling Point | 444.2ºC at 760 mmHg | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.4ºC | |
| Name | 4-[(2-hydroxy-3-oxoprop-1-enyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 444.2ºC at 760 mmHg |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18300 |
| Flash Point | 222.4ºC |
| Exact Mass | 207.05300 |
| PSA | 90.12000 |
| LogP | 2.04450 |
| Index of Refraction | 1.676 |
| InChIKey | MRHDDYZBPVATQA-UITAMQMPSA-N |
| SMILES | O=CC(O)=CNc1ccc(C(=O)O)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-[[(E)-2-hydroxy-3-oxo-prop-1-enyl]amino]benzoic acid |
| Triosereducton-monoanil |