methyl 2-(methoxycarbonylmethylsulfonylmethylsulfonyl)acetate structure
|
Common Name | methyl 2-(methoxycarbonylmethylsulfonylmethylsulfonyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 74705-20-7 | Molecular Weight | 288.29500 | |
| Density | 1.492g/cm3 | Boiling Point | 551.6ºC at 760 mmHg | |
| Molecular Formula | C7H12O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.4ºC | |
| Name | methyl 2-[(2-methoxy-2-oxoethyl)sulfonylmethylsulfonyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 551.6ºC at 760 mmHg |
| Molecular Formula | C7H12O8S2 |
| Molecular Weight | 288.29500 |
| Flash Point | 287.4ºC |
| Exact Mass | 287.99700 |
| PSA | 137.64000 |
| LogP | 0.28110 |
| Index of Refraction | 1.489 |
| InChIKey | ILDRESNKPLFXAU-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)(=O)CS(=O)(=O)CC(=O)OC |
|
~%
methyl 2-(metho... CAS#:74705-20-7 |
| Literature: Baliah, V.; Prema, S.; Jawaharsingh, C. B.; Chockalingam, K. N.; Jeyaraman, R. Synthesis, 1981 , # 12 p. 995 - 996 |
|
~%
methyl 2-(metho... CAS#:74705-20-7 |
| Literature: Ahern, Terence Patrick; Fong, Harvey Owen; Langler, Richard Francis; Mason, Peter Michael Canadian Journal of Chemistry, 1980 , vol. 58, p. 878 - 883 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| dimethyl methylenedisulfonyldiacetate |
| Dimethyl Methylene-bis-sulfonylacetate |