1H-Benzimidazole,6-methyl-2-(2-pyridinyl)- structure
|
Common Name | 1H-Benzimidazole,6-methyl-2-(2-pyridinyl)- | ||
|---|---|---|---|---|
| CAS Number | 7471-12-7 | Molecular Weight | 209.24700 | |
| Density | 1.231g/cm3 | Boiling Point | 438ºC at 760 mmHg | |
| Molecular Formula | C13H11N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.3ºC | |
Use of 1H-Benzimidazole,6-methyl-2-(2-pyridinyl)-ecMetAP-IN-1 (compound 17) is a potent ecMetAP inhibitor with an IC50 value of 2.086 µM[1]. |
| Name | 6-methyl-2-pyridin-2-yl-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Description | ecMetAP-IN-1 (compound 17) is a potent ecMetAP inhibitor with an IC50 value of 2.086 µM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 2.086 µM (ecMetAP)[1] |
| References |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 438ºC at 760 mmHg |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.24700 |
| Flash Point | 208.3ºC |
| Exact Mass | 209.09500 |
| PSA | 41.57000 |
| LogP | 2.93330 |
| Index of Refraction | 1.679 |
| InChIKey | HFYFOFMVURXVSD-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(-c3ccccn3)[nH]c2c1 |
| Storage condition | -20°C |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HMS1557J02 |
| 5-Methyl-2-pyridin-2-yl-1H-benzoimidazole |