2(1H)-Quinolinethione,7-chloro-4-methyl- structure
|
Common Name | 2(1H)-Quinolinethione,7-chloro-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 7471-19-4 | Molecular Weight | 209.69500 | |
| Density | 1.36g/cm3 | Boiling Point | 293.8ºC at 760mmHg | |
| Molecular Formula | C10H8ClNS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.5ºC | |
| Name | 7-chloro-4-methyl-1H-quinoline-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 293.8ºC at 760mmHg |
| Molecular Formula | C10H8ClNS |
| Molecular Weight | 209.69500 |
| Flash Point | 131.5ºC |
| Exact Mass | 209.00700 |
| PSA | 47.88000 |
| LogP | 3.85920 |
| Index of Refraction | 1.684 |
| InChIKey | LSEISBSNELHXAE-UHFFFAOYSA-N |
| SMILES | Cc1cc(=S)[nH]c2cc(Cl)ccc12 |
|
~%
2(1H)-Quinoline... CAS#:7471-19-4 |
| Literature: Renfrew Journal of the American Chemical Society, 1946 , vol. 68, p. 1433,1435 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7-Chlor-4-methyl-chinolin-2-thiol |
| 7-chloro-4-methyl-quinoline-2-thiol |
| 7-Chloro-4-methylthiocarbostyril |