2-Phenanthrenecarboxylicacid, 1,2,3,4-tetrahydro-2-methyl-1-oxo-, methyl ester structure
|
Common Name | 2-Phenanthrenecarboxylicacid, 1,2,3,4-tetrahydro-2-methyl-1-oxo-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 7471-36-5 | Molecular Weight | 268.30700 | |
| Density | 1.203g/cm3 | Boiling Point | 415.7ºC at 760mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5ºC | |
| Name | methyl 2-methyl-1-oxo-3,4-dihydrophenanthrene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 415.7ºC at 760mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 184.5ºC |
| Exact Mass | 268.11000 |
| PSA | 43.37000 |
| LogP | 3.14800 |
| Index of Refraction | 1.603 |
| InChIKey | ILMFCMIMBMTSIG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C)CCc2c(ccc3ccccc23)C1=O |
|
~%
2-Phenanthrenec... CAS#:7471-36-5 |
| Literature: Bachmann; Wilds Journal of the American Chemical Society, 1940 , vol. 62, p. 2084,2085 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-methyl-1-oxo-1,2,3,4-tetrahydro-phenanthrene-2-carboxylic acid methyl ester |
| methyl 2-methyl-1-oxo-1,2,3,4-tetrahydrophenanthrene-2-carboxylate |
| 2-Methyl-1-oxo-1,2,3,4-tetrahydro-phenanthren-2-carbonsaeure-methylester |