1,4-Naphthalenediol,2-(diphenylmethyl)-3-methyl-, 1,4-diacetate structure
|
Common Name | 1,4-Naphthalenediol,2-(diphenylmethyl)-3-methyl-, 1,4-diacetate | ||
|---|---|---|---|---|
| CAS Number | 7471-48-9 | Molecular Weight | 424.48800 | |
| Density | 1.184g/cm3 | Boiling Point | 544.6ºC at 760 mmHg | |
| Molecular Formula | C28H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.9ºC | |
| Name | (4-acetyloxy-3-benzhydryl-2-methylnaphthalen-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 544.6ºC at 760 mmHg |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.48800 |
| Flash Point | 270.9ºC |
| Exact Mass | 424.16700 |
| PSA | 52.60000 |
| LogP | 6.17900 |
| Index of Refraction | 1.616 |
| InChIKey | ROPYOEGDEVVEET-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c(C)c(C(c2ccccc2)c2ccccc2)c(OC(C)=O)c2ccccc12 |
|
~%
1,4-Naphthalene... CAS#:7471-48-9 |
| Literature: Fieser; Hartwell Journal of the American Chemical Society, 1935 , vol. 57, p. 1479,1481 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-diacetoxy-2-benzhydryl-3-methyl-naphthalene |
| (2-Methyl-3-benzhydryl-naphthalindiyl-(1,4))-diacetat |
| 1,4-Diacetoxy-2-benzhydryl-3-methyl-naphthalin |
| 1,4-Diacetoxy-2-methyl-3-diphenylmethyl-naphthalin |
| (2-Methyl-3-benzhydryl-naphthylen-(1,4))-diacetat |