7-(2-bromoethoxy)-4-methyl-chromen-2-one
7-(2-bromoethoxy)-4-methyl-chromen-2-one structure
|
Common Name | 7-(2-bromoethoxy)-4-methyl-chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 7471-76-3 | Molecular Weight | 283.11800 | |
| Density | 1.499g/cm3 | Boiling Point | 415.6ºC at 760mmHg | |
| Molecular Formula | C12H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(2-bromoethoxy)-4-methylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.499g/cm3 |
|---|---|
| Boiling Point | 415.6ºC at 760mmHg |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.11800 |
| Flash Point | 205.2ºC |
| Exact Mass | 281.98900 |
| PSA | 39.44000 |
| LogP | 2.87510 |
| InChIKey | XLLJFWFFIDCGMI-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc(OCCBr)ccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
7-(2-bromoethox... CAS#:7471-76-3 |
| Literature: Xi, Hai-Tao; Xiong, Min-Qiu; Wang, Lei-Lei; Hu, Quan-Zi; Sun, Xiao-Qiang Journal of the Chinese Chemical Society, 2010 , vol. 57, # 4 A p. 612 - 615 |
|
~%
7-(2-bromoethox... CAS#:7471-76-3 |
| Literature: Zhou, Xiang; Chen, Ya-Dong; Wang, Tao; Wang, Xiao-Bing; Kong, Ling-Yi Chemistry and Biodiversity, 2011 , vol. 8, # 6 p. 1052 - 1064 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
![4-methyl-7-[2-(4-methyl-2-oxochromen-7-yl)oxyethoxy]chromen-2-one structure](https://image.chemsrc.com/caspic/091/66346-10-9.png)
CAS#:66346-10-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-(2'-bromo-ethyl-oxy)-4-methyl-coumarin |
| 7-bromoethoxy-4-methylcoumarin |
| 4-methyl-7-(2'-bromoallyloxy)coumarin |
| 7-(2-bromoethyloxy)-4-methylbenzopyran-2-one |
| 7-(2-Brom-aethoxy)-4-methyl-cumarin |
| 7-(2-bromo-ethoxy)-4-methyl-chromen-2-one |
| 7-(2-bromoethoxy)-4-methyl-2H-chromen-2-one |
| 7-(2-Brom-allyloxy)-4-methyl-cumarin |
| 7-[(2-bromoallyl)oxy]-4-methyl-2H-chromen-2-one |
| 7-(2-bromoethoxy)-4-methyl-coumarin |
| 7-(2-bromo-allyloxy)-4-methyl-coumarin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 7-(2-bromoethoxy)-4-methylchromen-2-one? |
| A: CAS number of 7-(2-bromoethoxy)-4-methylchromen-2-one is 7471-76-3. |
| Q: What is the molecular weight of 7-(2-bromoethoxy)-4-methylchromen-2-one? |
| A: Molecular weight of 7-(2-bromoethoxy)-4-methylchromen-2-one is 283.11800. |
| Q: What are the downstream products of 7-(2-bromoethoxy)-4-methylchromen-2-one? |
| A: Related downstream products(CAS) of 7-(2-bromoethoxy)-4-methylchromen-2-one: 66346-10-9. |
| Q: What is the InChIKey of 7-(2-bromoethoxy)-4-methylchromen-2-one? |
| A: InChIKey of 7-(2-bromoethoxy)-4-methylchromen-2-one is XLLJFWFFIDCGMI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 7471-76-3? |
| A: Chinese name of 7471-76-3 is 7471-76-3. |
| Q: What is the boiling point of 7-(2-bromoethoxy)-4-methylchromen-2-one? |
| A: Boiling point of 7-(2-bromoethoxy)-4-methylchromen-2-one is 415.6ºC at 760mmHg. |
| Q: What are the upstream materials of 7-(2-bromoethoxy)-4-methylchromen-2-one? |
| A: Related upstream materials(CAS) of 7-(2-bromoethoxy)-4-methylchromen-2-one: 90-33-5;106-93-4;108-46-3. |
| Q: What is the polar surface area (PSA) of 7-(2-bromoethoxy)-4-methylchromen-2-one? |
| A: Polar surface area (PSA) of 7-(2-bromoethoxy)-4-methylchromen-2-one is 39.44000. |
| Q: What is the LogP of 7-(2-bromoethoxy)-4-methylchromen-2-one? |
| A: LogP of 7-(2-bromoethoxy)-4-methylchromen-2-one is 2.87510. |
| Q: What is the SMILES notation of 7-(2-bromoethoxy)-4-methylchromen-2-one? |
| A: SMILES notation of 7-(2-bromoethoxy)-4-methylchromen-2-one is Cc1cc(=O)oc2cc(OCCBr)ccc12. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |