9H-Purin-2-amine,N-(2-furanylmethyl)-6-(1-piperidinyl)- structure
|
Common Name | 9H-Purin-2-amine,N-(2-furanylmethyl)-6-(1-piperidinyl)- | ||
|---|---|---|---|---|
| CAS Number | 7471-83-2 | Molecular Weight | 298.34300 | |
| Density | 1.48g/cm3 | Boiling Point | 448.5ºC at 760mmHg | |
| Molecular Formula | C15H18N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine |
|---|
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760mmHg |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.34300 |
| Flash Point | 225.1ºC |
| Exact Mass | 298.15400 |
| PSA | 82.87000 |
| LogP | 2.68630 |
| Index of Refraction | 1.753 |
| InChIKey | MGLCMUASMKMPDO-UHFFFAOYSA-N |
| SMILES | c1coc(CNc2nc(N3CCCCC3)c3[nH]cnc3n2)c1 |
|
~%
9H-Purin-2-amin... CAS#:7471-83-2 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |