9H-Purin-2-amine,N-(2-furanylmethyl)-6-(1-piperidinyl)
9H-Purin-2-amine,N-(2-furanylmethyl)-6-(1-piperidinyl) structure
|
Common Name | 9H-Purin-2-amine,N-(2-furanylmethyl)-6-(1-piperidinyl) | ||
|---|---|---|---|---|
| CAS Number | 7471-83-2 | Molecular Weight | 298.34300 | |
| Density | 1.48g/cm3 | Boiling Point | 448.5ºC at 760mmHg | |
| Molecular Formula | C15H18N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760mmHg |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.34300 |
| Flash Point | 225.1ºC |
| Exact Mass | 298.15400 |
| PSA | 82.87000 |
| LogP | 2.68630 |
| Index of Refraction | 1.753 |
| InChIKey | MGLCMUASMKMPDO-UHFFFAOYSA-N |
| SMILES | c1coc(CNc2nc(N3CCCCC3)c3[nH]cnc3n2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
9H-Purin-2-amin... CAS#:7471-83-2 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine? |
| A: Polar surface area (PSA) of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine is 82.87000. |
| Q: What is the SMILES notation of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine? |
| A: SMILES notation of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine is c1coc(CNc2nc(N3CCCCC3)c3[nH]cnc3n2)c1. |
| Q: What is the LogP of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine? |
| A: LogP of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine is 2.68630. |
| Q: What are the upstream materials of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine? |
| A: Related upstream materials(CAS) of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine: 617-89-0;4854-10-8. |
| Q: What is the InChIKey of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine? |
| A: InChIKey of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine is MGLCMUASMKMPDO-UHFFFAOYSA-N. |
| Q: What is the boiling point of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine? |
| A: Boiling point of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine is 448.5ºC at 760mmHg. |
| Q: What is the CAS number of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine? |
| A: CAS number of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine is 7471-83-2. |
| Q: What is the Chinese name of 7471-83-2? |
| A: Chinese name of 7471-83-2 is 7471-83-2. |
| Q: What is the molecular formula of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine? |
| A: Molecular formula of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine is C15H18N6O. |
| Q: What is the molecular weight of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine? |
| A: Molecular weight of N-(furan-2-ylmethyl)-6-piperidin-1-yl-7H-purin-2-amine is 298.34300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |